25.0 g of barium hydroxide is dissolved in 120.0g of water. What is the morality?

Answers

Answer 1

Answer: Molarity: M = #moles of solute / liters of solution

# moles = mass / molar mass

Molar mass calculation

Barium hydroxide = Ba (OH)2

Atomic masses
Ba = 137.4 g/mol
O=16 g/mol
H=1 g/mol
Molar mass of Ba (OH)2 = 137.4 g/mol + 2*16g/mol + 2*1 g/mol = 171.4 g/mol

# mol = 25.0g/171.4 g/mol = 0.146 mol

For the volume of water use the fact that the density is 1g/ml., so 120 g = 120 ml = 0,120 liters.

M = 0.146mol / 0.120 liters = 1.22 mol/liter

Related Questions

In the combustion of hydrocarbon, carbon monoxide is formed. What has occured?
Using the following thermochemical data, what is the change in enthalpy for the following reaction:3H2(g) + 2C(s) + ½O2(g) → C2H5OH(l)C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l), ΔH = –1367 kJ/molC(s)+O2(g)→CO2(g), ΔH = –393.5 kJH2(g)+½O2(g)→H2O(l), ΔH = –285.8 kJa. -277.6 kJ/molb. -194.7 kJ/molc. 194.7 kJ/mold. 486 kJ/mol
What is the mass of an aluminum cylinder that has a volume of 1.50m3
When both forward and reverse changes are physical changes, the resulting equation represents a _____. a. physical equilibrium b. chemical equilibrium c. reversible reaction d. none of the above
Measuring how quickly a reactant disappears is one way to measure the ______________of the reaction

which of the following substances diffuses faster in a beaker filled with water a drop of honey or drop of red ink

Answers

red ink since the substance is has a lower viscosity

red ink because it is more soluble in water than honey.

Explain a polar molecules and give examples

Answers

Ethanol is polar because the oxygen atoms attract electrons because of their higher electronegativity than other atoms in the molecule. Thus the -OH group in ethanol has a slight negative charge. Ammonia (NH3) is polar. Sulfur dioxide (SO2) is polar.

If the temperature remains constant, an increase in pressure will

Answers

Have a decrease in volume.

By increasing the pressure, the volume must be decreasing because the particles are closer together and will be colliding more—which causes pressure.

For Gay-Lussac's law, temperature is measured in _____.

Answers

For Scientist Joseph Louis Gay-Lussac's law, temperature is measured on an absolute scale, specifically Kelvins or k. The formula may be expressed in P/T=k (P over T equals k). The answer to this question is 'kelvins'. I hope this helps.

What is the maximum mass of glucose (C6H12O6) that can be burned in 10 g of oxygen?

Answers

$C_6H_(12)O_6 + 6 \ O_2 \to 6 \ CO_2 + 6 \ H_2O$
1 mole of glucose : 6 moles of oxygen

First calculate the number of moles of oxygen in 10 g:
$M=32 \ (g)/(mol) \nm=10 \ g \nn=(10 \ g)/(32 \ (g)/(mol))=0.3125 \ mol$

1 mole of glucose reacts with 6 moles of oxygen
x moles of glucose reacts with 0.3125 moles of oxygen
$x=(1 \ mol \cdot 0.3125 \ mol)/(6 \ mol) = (3125)/(60000) \ mol= (5)/(96) \ mol$

Now calculate the mass of 5/96 moles of glucose.
$M=180 \ (g)/(mol) \nn=(5)/(96) \ mol \nm=180 \ (g)/(mol) \cdot (5)/(96) \ mol=(900)/(96) \ g=9.375 \ g$

The maximum mass of glucose that can be burned in 10 g of oxygen is 9.375 g.

A 134.0 g sample of an unknown metal is heated to 91.0⁰C and then placed in 125 g (125 mL) of water at 25.0⁰C. The final temperature of the water is measured at 31.0⁰C. Calculate the specific heat capacity of the unknown metal.