Ndividuals living in highly populated areas are more inclined to _______.a.
violence
b.
social interaction
c.
appetite loss
d.
all of the above

Answers

Answer 1

Answer:

Answer:

B. Social Interaction.

Explanation:

Related Questions

What occurs when a light wave enters a substance and its speed suddenly slowsdown? refraction Olightening Oreflection the vacuum effect
A train travels due south at 20 m/s. It reverses its direction and travels due north at 20 m/s. What is the change in velocity of the train? 50 m/s, due south e50 m/s, due north 120 m/s, due south zero ms 40 m/s, due north
Net force is the sum of all the forces acting on an object. If a spring balance pulls on a body with a force of 10 N, and friction acts on the body in the opposite direction with a force of 1 N, the net force would be 9 N in the direction of the spring balance (10 N – 1 N = 9 N).What is the net force acting on the object when the spring balance pulls the rope with a force of 25 N and friction acts on the body with a force of 20N?
Since fusion and fission are opposite processes that both produce energy,why can we not simply run the process forward and then backwardrepeatedly and have a limitless supply of energy?A. The products of a fission reaction cannot be used for a fusionreaction, and the products of a fusion reaction cannot be used fora fission reaction.B. Fusion reactions can occur cheaply enough, but fission requiresvery high temperatures.C. Fusion produces energy from nuclei larger than iron, and fissionproduces energy from nuclei smaller than iron.D. Fission reactions can occur cheaply enough, but fusion requires very high temperatures
If a coil stays at rest in a very large static magnetic field, no emf is induced in this coil. Group of answer choices True False

Which describes one feature of the image formed by a convex mirror?????

Answers

Answer:

The image formed by a convex mirror will always have its smaller than the size of the object no matter what the position of the object.

Explanation:

The image formed by a convex mirror will always have its smaller than the size of the object no matter what the position of the object.

Also notice that convex mirror always makes virtual images.

Another feature of the convex mirror is that an upright image is always formed by the convex mirror.

An important mirror formula to remember which is applicable for both convex and mirrors

1/f= 1/u + 1/v

Here:

'u' is an object which gets placed in front of a spherical mirror of focal

length 'f' and image 'u' is formed by the mirror.

Answer:

right side up

Explanation:

Which one defines force?

Answers

Answer:

Explanation:

a push or a pull that occurs when an object interacts with another object or field.

pls mrk me brainliest

Air contains 78.08% nitrogen, 20.095% oxygen, and 0.93% argon. calculate the partial pressure of oxygen if the total pressure of the air sample is 1.7 atm.a.

Answers

partial pressure in a mixture of two or more gases will be given by formula

$P_(partial)$ = mole fraction of gas * total pressure

now here mole fraction is same as percentage of gas in the mixture

Now mole fraction of oxygen is 0.20095 (20.095%)

now here pressure of oxygen in the mixture is given as

$P_(o_2) = 0.20095 * P_(total)$

$P_(o_2) = 0.20095 * 1.7$

$P_(o_2) = 0.342 atm$

so pressure due to oxygen in the mixture will be 0.342 atm

Answer:

20.095

Explanation:

The voltage difference between the AA and AAA batteries should be quite small. What then might be the difference between them?

Answers

Answer:

The major difference is the capacity of both batteries. The AA battery has a higher capacity (a higher current) than the AAA battery.

Explanation:

The AA batteries and the AAA batteries are very similar in their voltage; both of them have 1.5 V.

The difference between these two batteries is their size and also the current that they have. The AAA battery is smaller than the AA battery, which means that the amount of electrochemical material is lower, so the AA battery has a higher capacity (a higher current) than the AAA battery.Generally, AA battery has 2400 mAh capacity and AAA battery has a capacity of 1000mAh; this means that AA battery has almost three times the capacity of an AAA battery.

Furthermore, the size of the AA battery makes it more common than the AAA battery and therefore has higher commercial demand.

I hope it helps you!

The uniform crate has a mass of 50 kg and rests on the cart having an inclined surface. Determine the smallest acceleration that will cause the crate either to tip or slip relative to the cart. What is the magnitude of this acceleration

Answers

Answer:

The answer is below

Explanation:

Let g = acceleration due to gravity = 9.81 m/s², x = half of the width of the crate, half of the height of the crate = 0.5 m, a = acceleration of crate, N = force raising the crate

The sum of moment is given as:

$50asin(15)x+50acos(15)0.5=-50(9.81)sin(15)0.5+50(9.81)cos(15)x\ \ \ (1)$

Sum of vertical forces is zero, hence:

$N-50(9.81)cos(15)+50acos(15)=0\ \ \ (2)$

Sum of horizontal force is zero, hence:

$50(9.81)sin(15)-\mu N+50acos(15)=0\n\n50(9.81)sin(15)-0.5 N+50acos(15)=0\ \ \ (3)$

Solving equation 1, 2 and 3 simultaneously gives :

N = 447.8 N, a = 2.01 m/s², x = 0.25 m

x is supposed to be 0.3 m (0.6/2)

The crate would slip because x <0.3 m

Which of the following statements correctly compares the relationship between the earth, its atmosphere and radiation?1. The earth is cooled and its atmosphere is heated by solar radiation.

2. The earth is heated and its atmosphere is cooled by terrestrial radiation.

3. The earth is cooled and its atmosphere is heated by terrestrial radiation.

4. The earth is heated and its atmosphere is cooled by solar radiation.

Don't answer unless you know for sure. Thank you so much!

Answers

Answer: The option 4 is correct answer.

Explanation:

Terrestrial radiation is a long wave electromagnetic radiation. It originates from the earth and its atmosphere.

The sun emits a huge amount of energy. It travels across the space. The atmosphere is not directly heated by the solar radiation. It is heated by the terrestrial radiation that the planet itself emits.

When the land is heated then it emits radiation which heats up the atmosphere.

The earth is cooled and its atmosphere is heated by terrestrial radiation.

Therefore, the relationship between the earth, its atmosphere and radiation is correctly compared by statement 4.

The earth is cooled and its atmosphere is heated by terrestrial radiation.

Other Questions

Of the four most important pathways by which stress affects health, the first one to occuris usually related to physiology

What is the density of the paint if the mass of a tin containing 5000 cm3 paint is 7 kg. If the mass of the empty tin, including the lid is 0.5 kg.

Ken Griffey, Jr's warehouse shot in the 1933 home run derby travelled 93 feet per second for 5 seconds. How far did he hit the ball?

A 0.26 kg rock is thrown vertically upward from the top of a cliff that is 32 m high. When it hits the ground at the base of the cliff, the rock has a speed of 29 m/s. Assuming that air resistance can be ignore and using conservation of mechanical energy, find (a) the initial speed of the rock and (b) the greatest height of the rock as measured from the base of the cliff.