What do the formulas for table salt, NaCl, and water, H2O indicate about the compounds?

Answers

Answer 1

Answer: The formulas indicate the number of elements in each compound. Notice the difference in ratios:
NaCl is 1:1, while H2O is 2:1.

Related Questions

Mr. Smith wanted to see if the color of light shined on a plant had an effect on the number of leaves it had. He gathered 2 groups of the same species of plants, gave them the same amount of water, and did the test for the same amount of time. On one group of plants he used white light. For the second group he changed the light color to red.
These statements describe three different reactions. 1 - An atom shares electrons with another atom. 2 - The nucleus of an atom is split apart. 3 - An atom gains an electron from another atom. Which reaction(s) most likely release the greatest amount of energy? 1 2 1 and 3 2 and 3
Sometimes people say that the air is thinner high up on a mountain is that true
Using the following thermochemical data, what is the change in enthalpy for the following reaction:3H2(g) + 2C(s) + ½O2(g) → C2H5OH(l)C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l), ΔH = –1367 kJ/molC(s)+O2(g)→CO2(g), ΔH = –393.5 kJH2(g)+½O2(g)→H2O(l), ΔH = –285.8 kJa. -277.6 kJ/molb. -194.7 kJ/molc. 194.7 kJ/mold. 486 kJ/mol
Why does the forward reaction slow down over time

the combustion of propane may be described by the chemical equation, C3H8(g) + 5O2(g) --> 3CO2(g) + 4H2O(g)

how many grams of O2(g) are needed to completely burn 40.4 g of C3H8(g)?

Answers

$\nu_(C_3H_8)=(40.4)/(\mu_(C_3H_8))=$
$=(40.4)/(3A_C+8A_H)=(40.4)/(44)=$
$=(9)/(10)=0.9mol$
$1mol\ C_3H_8...5\ mol\ O_2 \n 0.9mol\ C_3H_8...x\ mol\ O_2$
$x=(0.9*5)/(1)=4.5mol\ O_2$
$m=\mu_(O_2)*x=2*A_O*4.5=9*8=72g\ O_2$

An aqueous solution has a mass of 490 gramscontaining 8.5 103 gram of calcium ions. The
concentration of calcium ions in this solution is
(1) 4.3 ppm (3) 17 ppm
(2) 8.5 ppm (4) 34 ppm

Answers

One way of expressing concentration is by expressing it by parts per million or ppm. Parts per million is equal to 1 milligram of solute per kilogram of solution. The problem is solved as follows:
ppm = .0085103 mg / .490 kg = 0.017 ppm

Which element is capable of forming long chains by forming single, double, or triple bonds with itself?

Answers

the answer is carbon

Catenation is the property by which it can make bonds with other carbon atoms to form long chains. Hence, carbon, with the least diffuse valence shell p orbital is capable of forming longer p-p sigma bonded chains of atoms than heavier elements which bond via higher valence shell orbitals.

Which two gases make up most of the atmosphere?

Answers

nitrogen wich comprises 78% of the atmosphere and oxygen wich accounts for 21%

Petroleum and coal can be mined from the continental shelf. t/f

Answers

True

Petroleum and coal can be mined from the continental shelf. Hot magma from inside the Earth seeps out from the crevices in the mid-ocean ridge. There is speculation regarding whether this is a cost-effective technique. Fossil fuels and mineral deposits can be located all throughout the continental shelf and also in some of the deepest depths of the ocean.

Answer:The given statement is true.

Explanation:

Continental Shelf: A portion of continent submerged under the relative shallow ocean water.Most of the gradually slopes down in to the water.

The relatively flat surface and shallow water makes it fitr place to harvest sea food, non renewable energy resources like : coal, petroleum .

What is the nuclear equation for the alpha decay of 173 Yb?

Answers

Yb 173 turns into Er 169 after alpha decay. you can find that by knowing an alpha particle is basically a helium nucleus with 2 protons and 2 neutrons. That means that Yt 173 loses 2 protons and 2 neutrons when undergoing alpha decay.

Other Questions

Does Silicon form a cation or is it anion?

He decayed organic material that gives soil its dark brown or black color is calledA) clay. B) humus. C) loam. Eliminate D) silt.

Potassium has nineteen protons. how many electrons does a neutral potassium atom have? a. 0 b. 17 c. 19 d. more information is needed to figure this out.

What proof did you see in the experiment that a chemical reaction took place?