How does the degree of disorder of a gas compare to that of a liquid or a solid? please explain your answer. this is a chemistry home work.

Answers

Answer 1

Answer: Molecules of gases are spaced far apart from each other compared to liquids and solids. This results in greater disorder in gas molecules. Liquid molecules are spaced slightly closer together than gas molecules, so the disorder is less than gas molecules. Solid molecules are the most tightly packed, and often vibrate in position. This gives solid molecules the least disorder.

Related Questions

A mover packs books, CDs, and DVDs into a moving box. If the box contains 6.5 kg of books, 1.5 kg of CDs, and 2.0 kg of DVDs, what is the percent by mass of each object in the box?
How many moles are represented by 250g of platinum?
What is the total number of grams of NaI(s)needed to make 1.0 liter of a 0.010 M solution?(1) 0.015 (3) 1.5(2) 0.15 (4) 15
Which is the electronic configuration for oxygen?1s2 2s2 2p1 1s2 2s2 2p31s2 2s2 2p41s2 2s2 2p6
Which statement correctly describes the charge of the nucleus and the charge of the electron cloud of an atom?(1) The nucleus is positive and the electron cloud is positive.(2) The nucleus is positive and the electron cloud is negative.(3) The nucleus is negative and the electron cloud is positive.(4) The nucleus is negative and the electron cloud is negative.

Consider this second-order reaction: (A B C and rate = k[A]2). What will happen to the reaction rate if the concentration of A is doubled?

Answers

Answer:

The reaction rate will be multiplied by four.

Explanation:

The reaction rate is the measure of how fast a reaction is happening, and it can be calculated by how fast the reactants are disappearing, or how fast the products are being formed.

For a generic reaction:

A → B + C

The rate (r) is:

-r = k*[A]ⁿ

The minus signal refers to the disappearing of the reactant, k is the velocity constant of the reaction, and n is the reaction order. So, for a second-order reaction:

-r = k*[A]²

If the concentration of A is doubled: [A]' = 2[A]

-r' = k*(2[A])²

-r' = k*4*[A]

-r' = 4*k*[A]

-r' = 4*(-r)

It will increase by a factor of four.

Nuclear fusion differs from nuclear fission because nuclear fusion reactions(1) form heavier isotopes from lighter isotopes
(2) form lighter isotopes from heavier isotopes
(3) convert mass to energy
(4) convert energy to mass

Answers

Nuclear fusion is the forceful collision of two nuclei to make a larger one
So the answer is (1)
(2) Would be nuclear fission
For (3) and (4), you can't convert energy from anything that isn't another form of energy, and you can't convert it in to anything that isn't another from of energy

Nuclear fusion differs from nuclear fission because nuclear fusion reactions. Nuclear fusion forms heavier isotopes from lighter isotopes. Nuclear fission forms lighter isotopes from heavier isotopes. therefore, the correct options are option 1,2.

Nuclear fission gets a nuclear process in which the atom's nucleus is divided into smaller nuclei by being blasted with low-energy neutrons. In this process, a large quantity of energy is released. Nuclear fission processes are employed for nuclear power reactors due to their simplicity and high energy output. When multiple atoms unite to produce one heavier nucleus, the process is known as nuclear fusion. In comparison to the energy produced throughout the nuclear fission reaction, a tremendous quantity of energy is released during this process.

To know more about nuclear fusion and nuclear fission, here:

brainly.com/question/13090058

#SPJ6

The elements carbon and sulfur are solids at room temperature. Can you reasonably predict that a compound of these two elements will also be a solid at room temperature?

Answers

Combining carbon and sulfur can result in compounds with various physical states at room temperature, such as solids (e.g., carbon disulfide) or gases (e.g., carbon dioxide). The state depends on the specific compound formed.

The type of chemical bonds and interactions that exist between a compound's components, as well as the temperature and pressure levels, all affect the compound's physical state.

While in their pure elemental forms, carbon and sulfur are both solid at ambient temperature, combining them to create a compound can produce a substance with a variety of qualities.

For instance, carbon and sulfur can combine to generate molecules like carbon disulfide, a volatile and extremely combustible liquid that exists at room temperature and at normal atmospheric pressure.

To learn more about physical states, follow the link:

brainly.com/question/33441240

#SPJ1

When K2SO4 is separated into its ions, how is it written?

Answers

Answer: $K^+$ and $SO_4^-^2$

Explanation: Potassium is a first group metal with one valence electron and so it has +1 charge. Sulfate ion is a polyatomic ion with -2 charge. The compound potassium sulfate has two potassium ions and one sulfate ion and the below equation shows how the ions are written when the compound is dissociated into its ions.

$K_2SO_4\rightarrow 2K^++SO_4^-^2$

When K2SO4 is separated into its ions, it is written like this.

K2SO4 -> 2K+ + SO4^-2.

This is a balanced equation.

A student observed that the rate of a chemical reaction increased as the temperature of the system increased. Which of the following statements best explains why thermal energy caused an increase in the reaction rate?A. The surface area of the product particles decreased.
B. The collision rate of the reactant particles increased.
C. The concentrations of the reactant particles increased.
D. The concentrations of the product particles decreased.

Answers

B, The increased thermal energy makes the particles move faster, making more collisions possible.

The answer is "B. The colllision rate of the reactant particles increased." because as you increase the temperature, the particles move faster and the faster the the particles move, the faster their collision rate.!!!

A supervisor spends a day inspecting a nuclear plant for potential radiation leaks. She has to move throughout the plant inspecting all the equipment and machinery. She needs to take two different radiation detection devices to help ensure her safety and to find radiation leaks. She needs the results immediately. Which two devices would be the best choices for the task?

Answers

In order to immediately detect traces and signs of radiation leaks in the nuclear power plant, the supervisor must use two devices that readily give its results. These devices could be a Geiger-Mueller tube or Geiger counter and a Personal Radiation Detector (PRD). A PRD has a very fast response time, while a Geiger counter also displays results real time.

Answer:

Geiger-Mueller tube or Geiger counter and a Personal Radiation Detector (PRD).

Explanation:

Other Questions

What is the most likely reason that nonmetals are electrical insulators?

Using the following thermochemical data, what is the change in enthalpy for the following reaction:3H2(g) + 2C(s) + ½O2(g) → C2H5OH(l)C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l), ΔH = –1367 kJ/molC(s)+O2(g)→CO2(g), ΔH = –393.5 kJH2(g)+½O2(g)→H2O(l), ΔH = –285.8 kJa. -277.6 kJ/molb. -194.7 kJ/molc. 194.7 kJ/mold. 486 kJ/mol

What characteristic is important for plants found in saltwater wetlands?

Gold and helium are examples of a(n)