CHEMISTRY HIGH SCHOOL

What is an exothermic chemical reaction?a. It is a reaction that converts matter to heat.
b. It is a reaction that requires heat to proceed.
c. It is a reaction that draws heat from its surroundings.
d. It is a reaction that releases heat to its surroundings.

Answers

Answer 1
Answer: Exo, meaning "out-", thermic meaning heat or temperature
Outgoing heat or a release of energy in the form of heat or light
Reactant -> Product + Energy

Therefore, the answer is D, it is a reaction that releases heat to its surroundings

Related Questions

What are some of the necessities of life?
Using the following thermochemical data, what is the change in enthalpy for the following reaction:3H2(g) + 2C(s) + ½O2(g) → C2H5OH(l)C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l), ΔH = –1367 kJ/molC(s)+O2(g)→CO2(g), ΔH = –393.5 kJH2(g)+½O2(g)→H2O(l), ΔH = –285.8 kJa. -277.6 kJ/molb. -194.7 kJ/molc. 194.7 kJ/mold. 486 kJ/mol
Use two analogies to describe quantized change.
Which is a product of a condensation reaction? 1. O2 2. CO2 3. H2 4. H2O
guys help please. A rigid container holds a gas at a pressure of 55 kPa and a temperature of -100.0°C. What will the pressure be when the temperature is increased to 200.0°C?

Which two gases make up most of the atmosphere?

Answers

nitrogen wich comprises 78% of the atmosphere and oxygen wich accounts for 21%

Choose the incorrect answer below concerning absolute zero.. . lowest possible temperature. theoretical temperature at which gas molecules have no kinetic energy. is equal to 0°C. is equal to 0 K

Answers

If it is to choose the incorrect answer concerning absolute zero, the lowest possible temperature, it would be the one that is equal to 0 degree centigrade, since that absolute zero in terms of degree Celsius would be -273. And if converted to Kelvin(K) would be 0.

is equal to 0°C is the answer :)

_______ is a media that consists of natural or synthetic mineral or plant substances that deposit crystalline or splinter-like fragments in the paper fibers.a. Dry media
c. Silverpoint
b. Ink painting
d. Liquid media

Answers

Answer : Option A) Dry media


Explanation : i) Dry media is a media that deposits graphite, charcoal, pastels, ordinary pencils, then moistened with a wet brush to get various painterly effects on the paper fibers.


ii) Silverpoint - Silverpoint media uses red chalk or traces of black pencil on white-coated paper usually the manuscripts,


iii) Ink Painting - Uses various inks on the paper.


iv) Liquid media - uses liquid pigments suspended in some base which in liquid state that soaks the paper.
Dry media is a media that consists of natural or synthetic mineral or plant substances that deposit crystalline or splinter-like fragments in the paper fibres. 

The rate constant (k) for the decay of the radioactive isotope I-131 is 3.6 x 10-3 hours 1. The slope of which of the following graphs is correct for the decay and could be used to confirm the value of k?

Answers

Answer:

Explanation:

pom, add

Match the following characteristics with their respective tissue types. [ Choose tissue can be multilayered and waterproof to protect from external threats or it can single layered to allow for gas and nutrient exchange this tissue's major function is to support and join other tissues [ Choose ] examples of this tissue are blood, bone, adipose tissue, loose and fibrous [Choose) this tissue type conveys information in the form of electrical transmission; found in the brain and spinal cord [Choose] epithelial tissue connective tissue nervous tissue muscle tissue this tissue type consists of long, thin cylindrical cells that have specialized proteins for contraction

Answers

Final answer:

Epithelial tissue can be multilayered and waterproof to protect from external threats, or single layered to allow for gas and nutrient exchange. Connective tissue supports and joins other tissues. Nervous tissue conveys information in the form of electrical transmission and is found in the brain and spinal cord. Muscle tissue consists of long, thin cylindrical cells that have specialized proteins for contraction.

Explanation:

The question is asking to match characteristics with their respective tissue types. There are four main types of tissues in the human body: epithelial tissue, connective tissue, nervous tissue, and muscle tissue.

Epithelial tissue is a protective tissue that can be multilayered and waterproof, or single layered to allow for exchange of gases and nutrients. It covers the surfaces of the body, lines the cavities and organs, and forms glands. Examples of epithelial tissue include the skin, the lining of the digestive tract, and the lining of blood vessels.

Connective tissue supports and joins other tissues. It provides structural support, connects and anchors organs, and stores energy. Examples of connective tissue include blood, bone, adipose tissue (fat), and fibrous tissue (tendons and ligaments).

Nervous tissue is responsible for transmitting electrical signals. It forms the brain, spinal cord, and nerves. Nervous tissue allows us to sense and respond to our environment, and it coordinates and controls body functions.

Muscle tissue consists of long, thin cylindrical cells that have specialized proteins for contraction. It allows for movement and generates force. There are three types of muscle tissue: skeletal muscle (attached to bones and responsible for voluntary movement), smooth muscle (found in the walls of organs and blood vessels, responsible for involuntary movement), and cardiac muscle (found in the heart and responsible for pumping blood).

Learn more about tissue types and their characteristics here:

brainly.com/question/31496357

#SPJ14

All of the questions

Answers

1. Oxygen
2. CO2 and H2O
3. Oxygen

Blanks...
Oxygen, nasal passage or mouth, nostrils, larnyx, trachea, bronchi, bronchioles, alveoli, chest cavity, diaphragm.
Other Questions
Which of the following statements about ice melting is true?A) Energy flows from the ice to its surroundings.B) Water molecules move from their fixed positions.C) Water molecules lose energy.
Calculate the number of kilojoules to warm 125 g of iron from 23.5 °C to 78.0 °C.
A solution containing large amount of solute in comparison to solvent is... A ) aqueous,b. concentrated, c. Diluted, and d. soluble
In a chemical reaction, substance R reacts with compound XY to produce 47.0 g of compound RX. If the theoretical yield of RX is 56.0 g, what is its percent yield?