ENGINEERING COLLEGE

Given that the debouncing circuit is somewhat expensive in terms of hardware (2 NAND gates, 2 resistors, and a double-pole, single throw switch), describe applications where you would require switch-debouncing circuits as well as applications where you would not need to include the additional hardware for switch debouncing (in other words, applications where you can tolerate switch bouncing). Note, you cannot use the clock and clear inputs of our lab as example applications; instead you need to think of other examples.

Answers

Answer 1
Answer:

Explanation:

One of the common application of debouncing g circuit is in microprocessors or microcontrollers or FPGA's where fast processing is required. In such cases, it is extremely important that during the limited processing cycle, the signals remains valid without debouncinng. Because debouncing can complete impact the output of the controller.

A case where debouncing can be compromised where a system is run partially through human intervention or that has different indications for one operation.

For example in a car wash management system, where green and red lights are used to indicate if a car is being washed, green light will be on and then red light means that there no car in washing que

Related Questions

You are analyzing an open-return wind tunnel that intakes air at 20 m/s and 320K. When the flow exits the wind tunnel it is moving at a speed of 250 m/s. What is the temperature of the flow exiting that wind tunnel
Write a C++ program to display yearly calendar. You need to use the array defined below in your program. // the first number is the month and second number is the last day of the month. into yearly[12][2] =
1. An automobile travels along a straight road at 15.65 m/s through a 11.18 m/sspeed zone. A police car observed the automobile. At the instant that the twovehicles are abreast of each other, the police car starts to pursue the automobile ata constant acceleration of 1.96 m/s². The motorist noticed the police car in his rearview mirror 12 s after the police car started the pursuit and applied his brakes and decelerates at 3.05 m/s². (Hint: The police will not go against the law.)a) Find the total time required for the police car to overtake the automobile.b) Find the total distance travelled by the police car while overtaking theautomobile.c) Find the speed of the police car at the time it overtakes the automobile.d) Find the speed of the automobile at the time it was overtaken by the police car.
A rocket is launched vertically from rest with a constant thrust until the rocket reaches an altitude of 25 m and the thrust ends. The rocket has mass 2 kg and thrust force 35 N. Neglecting air resistance, determine (a) the speed of the rocket when the thrust ends, (b) the maximum height reached by the rocket, and (c) the speed of the rocket when it returns to the ground.
(d) Arches NP is known for its spectacular arches that develop in the jointed areas of the park. Placemark Problem 2d flies you to Landscape Arch, the arch with the largest span in Arches NP. If the stresses that stretched the rock to form the joints were oriented perpendicular to the joint surfaces and the rock fins that contain the arches, what was the direction that the rocks were stretched? ☐ N-S ☐ E-W☐ NW-SE ☐ NE-SW

An inventor claims that he wants to build a dam to produce hydroelectric power. He correctly realizes that civilization uses a lot more electricity during the day than at night, so he thinks he has stumbled upon a great untapped energy supply. His plan is to install pumps at the bottom of the dam so that he can pump some of the water that flows out from the generators back up into the reservoir using the excess electricity generated at night. He reasons that if he did that, the water would just flow right back down through the generators the next day producing power for free. What is wrong with his plan?

Answers

Answer:

The problem is that the pumps would consume more energy than the generators would produce.

Explanation:

Water has a potential energy associated with the height it is at. The higher it is, the higher the potential energy. When water flows down into the turbines that energy is converted to kinetic energy and then into electricity.

A pump uses electricity to add energy to the water to send it to a higher potential energy state.

Ideally no net energy woul be hgenerate or lost, because the generators would release the potential energy and pumps would store it again in the water. However the systems are not ideal, everything has an efficiency and losses. The losses would accumulate and the generator would be generating less energy than the pumps consume, so that system wastes energy.

What should be done is closing the floodgates to keep the water up in the dam at night producing only the power that is needed and releasing more water during the day.

After the load impedance has been transformed through the ideal transformer, its impedance is: + . Enter the real part in the first blank and the imaginary part in the second blank. If a value is negative, include the negative sign. Provide up to four digits of precision. If the exact value can be provided with fewer digits, merely provide the exact value. These instructions pertain to the following blanks as well. What is the total impedance seen by the source? + . What is the current phasor Ig (expressed in rectangular form)?

Answers

Answer:

Ig =7.2 +j9.599

Explanation: Check the attachment

Compute the longitudinal tensile strength of an aligned glass fiber-epoxy matrix composite in which the average fiber diameter and length are 0.010 mm and 2.5 mm, respectively, and the volume fraction of fibers is 0.40. Assume that thefiber-matrixbondstrengthis75MPa, the fracture strength of the fibers is 3500 MPa and the matrix stress at fiber failure is 8.0 MPa.

Answers

Answer:

Explanation:

Given that,

Average fiber diameter is 0.01mm

d = 0.01mm = 1 × 10^-5m

The average fiber length is 2.5mm

L = 2.5mm = 0.0025m

Volume of the fraction of fibers is 0.40

Vf = 0.40

Fiber matrix bond strengths is 75MPa

τ = 75 MPa

The fraction strength of the fibers is 3500 Mpa

σf = 3500 MPa

The matrix street fiber is 8 MPa

σm = 8 MPa

We need to find the critical fiber length and compare it to original fiber length

Ic = σf•d / 2τ

Ic = 3500 × 0.01 / 75 × 2

Ic = 0.233 mm

Since the critical fiber length of 0.233 mm is much less than the provided length of the fiber (2.5mm) , so we can use the following equation to find the longitudinal tensile strength

σcd = σf•Vf(1—Ic / 2L) + σm(1—Vf)

σcd = 3500×0.4[1—0.233/(2 × 2.5)] + 8(1—0.4)

σcd = 1400(1—0.0467) + (8 × 0.6)

σcd = 1334.67 + 4.8

σcd = 1339.47 MPa

The longitudinal tensile strength of the aligned glass fiber-epoxy matrix composite is 1339.47 MPa

How much heat is lost through a 3’× 5' single-pane window with a storm that is exposed to a 60°F temperature differential?A. 450 Btu/hB. 900 Btu/hC. 1350 Btu/hD. 1800 Btu/h

Answers

Answer:

A. 450 btu/h

Explanation:

We solve this problem by using this formula:

Q = U x TD x area

U = U value of used material

TD = Temperature difference = 60°

Q = heat loss

Area = 3x5 = 15

We first find U

R = 1/u

2 = 1/U

U = 1/2 = 0.5

Then when we put these values into the formula above, we would have:

Q = 0.5 x 15 x 60

Q = 450Btu/h

Therefore 450btu/h is the answer

A 4-pole, 3-phase induction motor operates from a supply whose frequency is 60 Hz. calculate: 1- the speed at which the magnetic field of the stator is rotating

Answers

Answer:

The answer is below

Explanation:

A 4-pole, 3-phase induction motor operates from a supply whose frequency is 60 Hz. calculate: 1- the speed at which the magnetic field of the stator is rotating. 2- the speed of the rotor when the slip is 0.05. 3- the frequency of the rotor currents when the slip is 0.04. 4- the frequency of the rotor currents at standstill.

Given that:

number of poles (p) = 4, frequency (f) = 60 Hz

1) The synchronous speed of the motor is the speed at which the magnetic field of the stator is rotating. It is given as:

n_s=(120f)/(p)=(120*60)/(4)=1800\ rpm

2) The slip (s) = 0.05

The speed of the motor (n) is the speed of the rotor, it is given as:

n=n_s-sn_s\n\nn=1800-0.05(1800)\n\nn=1800-90\n\nn=1710\ rpm

3) s = 0.04

The rotor frequency is the product of the supply frequency and slip it is given as:

f_r=sf\n\nf_r=0.04*60\n\nf_r=2.4\ Hz

4) At standstill, the motor speed is zero hence the slip = 1:

s=(n_s-n)/(n_s)\n \nn=0\n\ns=(n_s-0)/(n_s)\n\ns=1

The rotor frequency is the product of the supply frequency and slip it is given as:

f_r=sf\n\nf_r=1*60\n\nf_r=60\ Hz

What is the De Broglie wavelength of an electron under 150 V acceleration?

Answers

Answer:

0.1 nm

Explanation:

Potential difference of the electron = 150 V

Mass of electron m=9.1* 10^(-31)kg

Charge on electron 1.6* 10^(-19)C

Plank's constant h=6.67* 10^(-34)

If the velocity of the electron is v

Then according to energy conservation eV =(1)/(2)mv^2

v=\sqrt{(2eV)/(m)}=\sqrt{(2* 1.6* 10^(-`19)* 150)/(9.1* 10^(-31))}=7.2627* 10^(6)m/sec

According to De Broglie \lambda =(h)/(mv)=(6.67* 10^(-34))/(9.1* 10^(-31)* 7.2627* 10^(6))=0.1nm
Other Questions
The following program includes fictional sets of the top 10 male and female baby names for the current year. Write a program that creates: A set all_names that contains all of the top 10 male and all of the top 10 female names. A set neutral_names that contains only names found in both male_names and female_names. A set specific_names that contains only gender specific names. Sample output for all_names: {'Michael', 'Henry', 'Jayden', 'Bailey', 'Lucas', 'Chuck', 'Aiden', 'Khloe', 'Elizabeth', 'Maria', 'Veronica', 'Meghan', 'John', 'Samuel', 'Britney', 'Charlie', 'Kim'}
Describe the difference between design guidelines or criteria and design performance. Explain the relationship between the use of guideline/criteria tools and performance tools during the design process
Convert the angles of a triangle to radians.Part A31∘43′53′′, 90∘32′11′′, 57∘43′56′′Express your answers, separated by commas, to six significant figures.nothingrad, rad, radRequest AnswerPart B94∘22′19′′, 40∘54′53′′, 44∘42′48′′Express your answers, separated by commas, to six significant figures.
Suppose there is a mobile application that can run in two modes: Lazy or Eager. In Lazy Mode, the execution time is 3.333 seconds. In Eager Mode, the app utilizes a faster timer resolution for its computations, so the execution time in Eager Mode is 2 seconds (i.e., Eager Mode execution time is 60% of Lazy Mode execution time).After finishing computation, the app sends some data to the cloud, regardless of the mode it’s in. The data size sent to the cloud is 600 MB. The bandwidth of communication is 15 MBps for WiFi and 5 MBps for 4G. Assume that the communication radio is idle during the computation time. Assume that the communication radio for WiFi has a power consumption of 75 mW when active and 15 mW when idle. Similarly, assume that the communication radio for 4G has a power consumption of 190 mW when active and 25 mW when idle. The Idle Power of the CPU is 7 mW, whereas the Active Power of the CPU is 5 mW per unit utilization. Assume that the power consumption of the CPU is a linear function of its utilization. In other words: P = (Idle Power) + (Utilization)*(Power per unit Utilization). A configuration of the mobile app involves choosing a timer resolution (Lazy or Eager) and choosing a type of radio (WiFi or 4G). For example, faster timer resolution (Eager) and 4G network is a configuration, while slower resolution (Lazy) and WiFi is another. There are four possible configurations in all.Required:What is the average power consumption for Eager WiFi, Lazy WiFi, Eager 4G, and Lazy 4G?